About 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid
5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid (PubChem CID 83696847) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 83696847 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid |
| SMILES | Nc1sc(C2CC2)nc1C(=O)O |
| InChI | InChI=1S/C7H8N2O2S/c8-5-4(7(10)11)9-6(12-5)3-1-2-3/h3H,1-2,8H2,(H,10,11) |
| InChIKey | PINDNCWWZDFGDP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid (CID 83696847) is 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid is Nc1sc(C2CC2)nc1C(=O)O.
What is the InChIKey of 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is PINDNCWWZDFGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c8-5-4(7(10)11)9-6(12-5)3-1-2-3/h3H,1-2,8H2,(H,10,11).
What are the key properties of 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid?
5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 184.22 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-cyclopropyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 83696847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).