About 5-cyclopentyl-N,6-dimethylpyridazin-3-amine
5-cyclopentyl-N,6-dimethylpyridazin-3-amine (PubChem CID 83697993) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 5-cyclopentyl-N,6-dimethylpyridazin-3-amine.
Molecular Properties
| Compound Name | 5-cyclopentyl-N,6-dimethylpyridazin-3-amine |
| PubChem CID | 83697993 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 5-cyclopentyl-N,6-dimethylpyridazin-3-amine |
| SMILES | CNc1cc(C2CCCC2)c(C)nn1 |
| InChI | InChI=1S/C11H17N3/c1-8-10(9-5-3-4-6-9)7-11(12-2)14-13-8/h7,9H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | PNODQBUWJZSTSH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-N,6-dimethylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-N,6-dimethylpyridazin-3-amine?
The IUPAC name of 5-cyclopentyl-N,6-dimethylpyridazin-3-amine (CID 83697993) is 5-cyclopentyl-N,6-dimethylpyridazin-3-amine.
What is the SMILES notation for 5-cyclopentyl-N,6-dimethylpyridazin-3-amine?
The canonical SMILES for 5-cyclopentyl-N,6-dimethylpyridazin-3-amine is CNc1cc(C2CCCC2)c(C)nn1.
What is the InChIKey of 5-cyclopentyl-N,6-dimethylpyridazin-3-amine?
The InChIKey is PNODQBUWJZSTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-8-10(9-5-3-4-6-9)7-11(12-2)14-13-8/h7,9H,3-6H2,1-2H3,(H,12,14).
What are the key properties of 5-cyclopentyl-N,6-dimethylpyridazin-3-amine?
5-cyclopentyl-N,6-dimethylpyridazin-3-amine has a molecular weight of 191.28 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-N,6-dimethylpyridazin-3-amine is sourced from PubChem (CID 83697993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).