C11H17N3 — CID 83697993
5-cyclopentyl-N,6-dimethylpyridazin-3-amine (PubChem CID 83697993) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 5-cyclopentyl-N,6-dimethylpyridazin-3-amine.
| Compound Name | 5-cyclopentyl-N,6-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 83697993 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 5-cyclopentyl-N,6-dimethylpyridazin-3-amine |
| SMILES | CNc1cc(C2CCCC2)c(C)nn1 |
| InChI | InChI=1S/C11H17N3/c1-8-10(9-5-3-4-6-9)7-11(12-2)14-13-8/h7,9H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | PNODQBUWJZSTSH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |