C13H19NS — CID 83707838
7-cyclohexyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 83707838) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 7-cyclohexyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 7-cyclohexyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 83707838 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 7-cyclohexyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | c1cc2c(s1)C(C1CCCCC1)CNC2 |
| InChI | InChI=1S/C13H19NS/c1-2-4-10(5-3-1)12-9-14-8-11-6-7-15-13(11)12/h6-7,10,12,14H,1-5,8-9H2 |
| InChIKey | OLEVSGAGKZFALQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |