About cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone
cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone (PubChem CID 83708253) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone.
Molecular Properties
| Compound Name | cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone |
| PubChem CID | 83708253 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone |
| SMILES | O=C(C1CCC1)N1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C13H22N2O/c16-12(11-2-1-3-11)15-9-6-13(10-15)4-7-14-8-5-13/h11,14H,1-10H2 |
| InChIKey | ADOAXTMRALWGPX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone?
The IUPAC name of cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone (CID 83708253) is cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone.
What is the SMILES notation for cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone?
The canonical SMILES for cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone is O=C(C1CCC1)N1CCC2(CCNCC2)C1.
What is the InChIKey of cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone?
The InChIKey is ADOAXTMRALWGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c16-12(11-2-1-3-11)15-9-6-13(10-15)4-7-14-8-5-13/h11,14H,1-10H2.
What are the key properties of cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone?
cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone has a molecular weight of 222.33 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl(2,8-diazaspiro[4.5]decan-2-yl)methanone is sourced from PubChem (CID 83708253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).