About 2-methylbenzoic acid
2-methylbenzoic acid (PubChem CID 8373) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2-methylbenzoic acid.
Molecular Properties
| Compound Name | 2-methylbenzoic acid |
| PubChem CID | 8373 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 2-methylbenzoic acid |
| SMILES | Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | ZWLPBLYKEWSWPD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzoic acid?
The IUPAC name of 2-methylbenzoic acid (CID 8373) is 2-methylbenzoic acid.
What is the SMILES notation for 2-methylbenzoic acid?
The canonical SMILES for 2-methylbenzoic acid is Cc1ccccc1C(=O)O.
What is the InChIKey of 2-methylbenzoic acid?
The InChIKey is ZWLPBLYKEWSWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 2-methylbenzoic acid?
2-methylbenzoic acid has a molecular weight of 136.15 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzoic acid is sourced from PubChem (CID 8373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).