C12H18N2 — CID 83753003
6-methyl-1-propan-2-yl-2,3-dihydroindol-3-amine (PubChem CID 83753003) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 6-methyl-1-propan-2-yl-2,3-dihydroindol-3-amine.
| Compound Name | 6-methyl-1-propan-2-yl-2,3-dihydroindol-3-amine |
|---|---|
| PubChem CID | 83753003 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 6-methyl-1-propan-2-yl-2,3-dihydroindol-3-amine |
| SMILES | Cc1ccc2c(c1)N(C(C)C)CC2N |
| InChI | InChI=1S/C12H18N2/c1-8(2)14-7-11(13)10-5-4-9(3)6-12(10)14/h4-6,8,11H,7,13H2,1-3H3 |
| InChIKey | XDCOTUBUIAJYJR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |