About 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol
3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 83753144) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol.
Molecular Properties
| Compound Name | 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol |
| PubChem CID | 83753144 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | Cc1cccc2c1N(C)CC(N)C2O |
| InChI | InChI=1S/C11H16N2O/c1-7-4-3-5-8-10(7)13(2)6-9(12)11(8)14/h3-5,9,11,14H,6,12H2,1-2H3 |
| InChIKey | VXDMQMUDOSCPPO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol?
The IUPAC name of 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol (CID 83753144) is 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol.
What is the SMILES notation for 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol?
The canonical SMILES for 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol is Cc1cccc2c1N(C)CC(N)C2O.
What is the InChIKey of 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol?
The InChIKey is VXDMQMUDOSCPPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-7-4-3-5-8-10(7)13(2)6-9(12)11(8)14/h3-5,9,11,14H,6,12H2,1-2H3.
What are the key properties of 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol?
3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol has a molecular weight of 192.26 g/mol, XLogP of 0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,8-dimethyl-3,4-dihydro-2H-quinolin-4-ol is sourced from PubChem (CID 83753144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).