C10H9ClO3 — CID 83754448
2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid (PubChem CID 83754448) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid.
| Compound Name | 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid |
|---|---|
| PubChem CID | 83754448 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid |
| SMILES | O=C(O)CC1COc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H9ClO3/c11-7-1-2-8-6(3-10(12)13)5-14-9(8)4-7/h1-2,4,6H,3,5H2,(H,12,13) |
| InChIKey | UFDNMYNCYATWIB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |