2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid

C10H9ClO3 — CID 83754448

IUPAC2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid
SMILESO=C(O)CC1COc2cc(Cl)ccc21
InChIInChI=1S/C10H9ClO3/c11-7-1-2-8-6(3-10(12)13)5-14-9(8)4-7/h1-2,4,6H,3,5H2,(H,12,13)
InChIKeyUFDNMYNCYATWIB-UHFFFAOYSA-N
MW212.63 g/mol
LogP2.29
Rot. Bonds2

About 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid

2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid (PubChem CID 83754448) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid.

Molecular Properties

Compound Name2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid
PubChem CID83754448
Molecular FormulaC10H9ClO3
Molecular Weight212.63 g/mol
Exact Mass212.02
IUPAC Name2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid
SMILESO=C(O)CC1COc2cc(Cl)ccc21
InChIInChI=1S/C10H9ClO3/c11-7-1-2-8-6(3-10(12)13)5-14-9(8)4-7/h1-2,4,6H,3,5H2,(H,12,13)
InChIKeyUFDNMYNCYATWIB-UHFFFAOYSA-N
XLogP2.29
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.63
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid?
The IUPAC name of 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid (CID 83754448) is 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid.
What is the SMILES notation for 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid?
The canonical SMILES for 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid is O=C(O)CC1COc2cc(Cl)ccc21.
What is the InChIKey of 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid?
The InChIKey is UFDNMYNCYATWIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO3/c11-7-1-2-8-6(3-10(12)13)5-14-9(8)4-7/h1-2,4,6H,3,5H2,(H,12,13).
What are the key properties of 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid?
2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid has a molecular weight of 212.63 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-2,3-dihydro-1-benzofuran-3-yl)acetic acid is sourced from PubChem (CID 83754448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).