About 6-bromo-1-methyl-2,3-dihydroinden-1-amine
6-bromo-1-methyl-2,3-dihydroinden-1-amine (PubChem CID 83756228) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is 6-bromo-1-methyl-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 6-bromo-1-methyl-2,3-dihydroinden-1-amine |
| PubChem CID | 83756228 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 6-bromo-1-methyl-2,3-dihydroinden-1-amine |
| SMILES | CC1(N)CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H12BrN/c1-10(12)5-4-7-2-3-8(11)6-9(7)10/h2-3,6H,4-5,12H2,1H3 |
| InChIKey | IDBQMDFPQLXTQK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1-methyl-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methyl-2,3-dihydroinden-1-amine?
The IUPAC name of 6-bromo-1-methyl-2,3-dihydroinden-1-amine (CID 83756228) is 6-bromo-1-methyl-2,3-dihydroinden-1-amine.
What is the SMILES notation for 6-bromo-1-methyl-2,3-dihydroinden-1-amine?
The canonical SMILES for 6-bromo-1-methyl-2,3-dihydroinden-1-amine is CC1(N)CCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-1-methyl-2,3-dihydroinden-1-amine?
The InChIKey is IDBQMDFPQLXTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c1-10(12)5-4-7-2-3-8(11)6-9(7)10/h2-3,6H,4-5,12H2,1H3.
What are the key properties of 6-bromo-1-methyl-2,3-dihydroinden-1-amine?
6-bromo-1-methyl-2,3-dihydroinden-1-amine has a molecular weight of 226.12 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methyl-2,3-dihydroinden-1-amine is sourced from PubChem (CID 83756228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).