C7H5N3O6 — CID 8376
2-methyl-1,3,5-trinitrobenzene (PubChem CID 8376) has the molecular formula C7H5N3O6 and a molecular weight of 227.13 g/mol. Its IUPAC name is 2-methyl-1,3,5-trinitrobenzene.
| Compound Name | 2-methyl-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 8376 |
| Molecular Formula | C7H5N3O6 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 2-methyl-1,3,5-trinitrobenzene |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3 |
| InChIKey | SPSSULHKWOKEEL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|