(E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid

C8H7NO3 — CID 83764679

IUPAC(E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1cccc(=O)[nH]1
InChIInChI=1S/C8H7NO3/c10-7-3-1-2-6(9-7)4-5-8(11)12/h1-5H,(H,9,10)(H,11,12)/b5-4+
InChIKeyIKUJLLPGBICFKN-SNAWJCMRSA-N
MW165.15 g/mol
LogP0.47
Rot. Bonds2

About (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid

(E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid (PubChem CID 83764679) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid
PubChem CID83764679
Molecular FormulaC8H7NO3
Molecular Weight165.15 g/mol
Exact Mass165.04
IUPAC Name(E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1cccc(=O)[nH]1
InChIInChI=1S/C8H7NO3/c10-7-3-1-2-6(9-7)4-5-8(11)12/h1-5H,(H,9,10)(H,11,12)/b5-4+
InChIKeyIKUJLLPGBICFKN-SNAWJCMRSA-N
XLogP0.47
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.15
LogP ≤ 50.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid (CID 83764679) is (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid is O=C(O)/C=C/c1cccc(=O)[nH]1.
What is the InChIKey of (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid?
The InChIKey is IKUJLLPGBICFKN-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H7NO3/c10-7-3-1-2-6(9-7)4-5-8(11)12/h1-5H,(H,9,10)(H,11,12)/b5-4+.
What are the key properties of (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid?
(E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid has a molecular weight of 165.15 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(6-oxo-1H-pyridin-2-yl)prop-2-enoic acid is sourced from PubChem (CID 83764679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).