About (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid
(E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid (PubChem CID 83764773) has the molecular formula C5H5N3O2
and a molecular weight of 139.11 g/mol. Its IUPAC name is (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid |
| PubChem CID | 83764773 |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ncn[nH]1 |
| InChI | InChI=1S/C5H5N3O2/c9-5(10)2-1-4-6-3-7-8-4/h1-3H,(H,9,10)(H,6,7,8)/b2-1+ |
| InChIKey | RTHKKPZTBOIQJE-OWOJBTEDSA-N |
| XLogP | -0.10 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid (CID 83764773) is (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid is O=C(O)/C=C/c1ncn[nH]1.
What is the InChIKey of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid?
The InChIKey is RTHKKPZTBOIQJE-OWOJBTEDSA-N. The full InChI is InChI=1S/C5H5N3O2/c9-5(10)2-1-4-6-3-7-8-4/h1-3H,(H,9,10)(H,6,7,8)/b2-1+.
What are the key properties of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid?
(E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid has a molecular weight of 139.11 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid is sourced from PubChem (CID 83764773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).