About 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid
3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid (PubChem CID 83774485) has the molecular formula C7H4BrN3O2
and a molecular weight of 242.03 g/mol. Its IUPAC name is 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid |
| PubChem CID | 83774485 |
| Molecular Formula | C7H4BrN3O2 |
| Molecular Weight | 242.03 g/mol |
| Exact Mass | 240.95 |
| IUPAC Name | 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2ncccn2c1Br |
| InChI | InChI=1S/C7H4BrN3O2/c8-5-4(6(12)13)10-7-9-2-1-3-11(5)7/h1-3H,(H,12,13) |
| InChIKey | FUOASAGXHRWECF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.03 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid?
The IUPAC name of 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid (CID 83774485) is 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid.
What is the SMILES notation for 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid?
The canonical SMILES for 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid is O=C(O)c1nc2ncccn2c1Br.
What is the InChIKey of 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid?
The InChIKey is FUOASAGXHRWECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN3O2/c8-5-4(6(12)13)10-7-9-2-1-3-11(5)7/h1-3H,(H,12,13).
What are the key properties of 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid?
3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid has a molecular weight of 242.03 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoimidazo[1,2-a]pyrimidine-2-carboxylic acid is sourced from PubChem (CID 83774485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).