C16H16ClNO3 — CID 837798
(2S)-N-(5-chloro-2-hydroxyphenyl)-2-(2-methylphenoxy)propanamide (PubChem CID 837798) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-hydroxyphenyl)-2-(2-methylphenoxy)propanamide.
| Compound Name | (2S)-N-(5-chloro-2-hydroxyphenyl)-2-(2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 837798 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (2S)-N-(5-chloro-2-hydroxyphenyl)-2-(2-methylphenoxy)propanamide |
| SMILES | Cc1ccccc1O[C@@H](C)C(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H16ClNO3/c1-10-5-3-4-6-15(10)21-11(2)16(20)18-13-9-12(17)7-8-14(13)19/h3-9,11,19H,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | LLTRMAKQEBASMT-NSHDSACASA-N |
| XLogP | 3.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|