C14H14BrClO3 — CID 837878
(5R,6R)-5-bromo-6-(4-chlorophenyl)-3,3,5-trimethyloxane-2,4-dione (PubChem CID 837878) has the molecular formula C14H14BrClO3 and a molecular weight of 345.62 g/mol. Its IUPAC name is (5R,6R)-5-bromo-6-(4-chlorophenyl)-3,3,5-trimethyloxane-2,4-dione.
| Compound Name | (5R,6R)-5-bromo-6-(4-chlorophenyl)-3,3,5-trimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 837878 |
| Molecular Formula | C14H14BrClO3 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | (5R,6R)-5-bromo-6-(4-chlorophenyl)-3,3,5-trimethyloxane-2,4-dione |
| SMILES | CC1(C)C(=O)O[C@H](c2ccc(Cl)cc2)[C@@](C)(Br)C1=O |
| InChI | InChI=1S/C14H14BrClO3/c1-13(2)11(17)14(3,15)10(19-12(13)18)8-4-6-9(16)7-5-8/h4-7,10H,1-3H3/t10-,14-/m1/s1 |
| InChIKey | ITBXNPYKFCFEKK-QMTHXVAHSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|