C11H11F4N — CID 83808419
3-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 83808419) has the molecular formula C11H11F4N and a molecular weight of 233.21 g/mol. Its IUPAC name is 3-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 83808419 |
| Molecular Formula | C11H11F4N |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | Fc1ccc(C(F)(F)F)cc1C1CCNC1 |
| InChI | InChI=1S/C11H11F4N/c12-10-2-1-8(11(13,14)15)5-9(10)7-3-4-16-6-7/h1-2,5,7,16H,3-4,6H2 |
| InChIKey | UAMUAYAYGOXNLJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |