5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid

C10H6F2N2O2 — CID 83810701

IUPAC5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid
SMILESO=C(O)c1cn[nH]c1-c1cccc(F)c1F
InChIInChI=1S/C10H6F2N2O2/c11-7-3-1-2-5(8(7)12)9-6(10(15)16)4-13-14-9/h1-4H,(H,13,14)(H,15,16)
InChIKeySQAIGLZSAOWWMK-UHFFFAOYSA-N
MW224.17 g/mol
LogP2.05
Rot. Bonds2

About 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid

5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 83810701) has the molecular formula C10H6F2N2O2 and a molecular weight of 224.17 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid
PubChem CID83810701
Molecular FormulaC10H6F2N2O2
Molecular Weight224.17 g/mol
Exact Mass224.04
IUPAC Name5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid
SMILESO=C(O)c1cn[nH]c1-c1cccc(F)c1F
InChIInChI=1S/C10H6F2N2O2/c11-7-3-1-2-5(8(7)12)9-6(10(15)16)4-13-14-9/h1-4H,(H,13,14)(H,15,16)
InChIKeySQAIGLZSAOWWMK-UHFFFAOYSA-N
XLogP2.05
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.17
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid?
The IUPAC name of 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid (CID 83810701) is 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid.
What is the SMILES notation for 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid?
The canonical SMILES for 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid is O=C(O)c1cn[nH]c1-c1cccc(F)c1F.
What is the InChIKey of 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid?
The InChIKey is SQAIGLZSAOWWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2O2/c11-7-3-1-2-5(8(7)12)9-6(10(15)16)4-13-14-9/h1-4H,(H,13,14)(H,15,16).
What are the key properties of 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid?
5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid has a molecular weight of 224.17 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-difluorophenyl)-1H-pyrazole-4-carboxylic acid is sourced from PubChem (CID 83810701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).