C10H4F3NO3 — CID 83810758
5-(2,3,4-trifluorophenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 83810758) has the molecular formula C10H4F3NO3 and a molecular weight of 243.14 g/mol. Its IUPAC name is 5-(2,3,4-trifluorophenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2,3,4-trifluorophenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 83810758 |
| Molecular Formula | C10H4F3NO3 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 5-(2,3,4-trifluorophenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)c(F)c2F)on1 |
| InChI | InChI=1S/C10H4F3NO3/c11-5-2-1-4(8(12)9(5)13)7-3-6(10(15)16)14-17-7/h1-3H,(H,15,16) |
| InChIKey | MEBOUBLTJXBIPX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|