C11H18ClN3 — CID 83813273
N-(2-chloro-4-pyridinyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 83813273) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(2-chloro-4-pyridinyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 83813273 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H18ClN3/c1-3-15(4-2)8-7-13-10-5-6-14-11(12)9-10/h5-6,9H,3-4,7-8H2,1-2H3,(H,13,14) |
| InChIKey | ZIJTWWJRZBBFGA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|