About 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile
2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile (PubChem CID 83814255) has the molecular formula C10H9N3S2
and a molecular weight of 235.34 g/mol. Its IUPAC name is 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile.
Molecular Properties
| Compound Name | 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile |
| PubChem CID | 83814255 |
| Molecular Formula | C10H9N3S2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile |
| SMILES | Cc1nc(SCC#N)c2c(C)csc2n1 |
| InChI | InChI=1S/C10H9N3S2/c1-6-5-15-10-8(6)9(14-4-3-11)12-7(2)13-10/h5H,4H2,1-2H3 |
| InChIKey | FBIYOKZLBKVVQT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile?
The IUPAC name of 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile (CID 83814255) is 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile.
What is the SMILES notation for 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile?
The canonical SMILES for 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile is Cc1nc(SCC#N)c2c(C)csc2n1.
What is the InChIKey of 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile?
The InChIKey is FBIYOKZLBKVVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3S2/c1-6-5-15-10-8(6)9(14-4-3-11)12-7(2)13-10/h5H,4H2,1-2H3.
What are the key properties of 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile?
2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile has a molecular weight of 235.34 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetonitrile is sourced from PubChem (CID 83814255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).