C7H9N5S — CID 83814389
5-(1,5-dimethylpyrazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 83814389) has the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-(1,5-dimethylpyrazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(1,5-dimethylpyrazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 83814389 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 5-(1,5-dimethylpyrazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1cc(-c2nc(=S)[nH][nH]2)nn1C |
| InChI | InChI=1S/C7H9N5S/c1-4-3-5(11-12(4)2)6-8-7(13)10-9-6/h3H,1-2H3,(H2,8,9,10,13) |
| InChIKey | CICLHKMZGNUUGJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|