About cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile
cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile (PubChem CID 83814960) has the molecular formula C5H5N3
and a molecular weight of 107.12 g/mol. Its IUPAC name is cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile |
| PubChem CID | 83814960 |
| Molecular Formula | C5H5N3 |
| Molecular Weight | 107.12 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile |
| SMILES | N#C[C@@H]1C(N)[C@@H]1C#N |
| InChI | InChI=1S/C5H5N3/c6-1-3-4(2-7)5(3)8/h3-5H,8H2/t3-,4+,5? |
| InChIKey | UHUAQLJMGVLTLA-NGQZWQHPSA-N |
| XLogP | -0.39 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.12 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile?
The IUPAC name of cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile (CID 83814960) is cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile.
What is the SMILES notation for cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile?
The canonical SMILES for cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile is N#C[C@@H]1C(N)[C@@H]1C#N.
What is the InChIKey of cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile?
The InChIKey is UHUAQLJMGVLTLA-NGQZWQHPSA-N. The full InChI is InChI=1S/C5H5N3/c6-1-3-4(2-7)5(3)8/h3-5H,8H2/t3-,4+,5?.
What are the key properties of cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile?
cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile has a molecular weight of 107.12 g/mol, XLogP of -0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-3-aminocyclopropane-1,2-dicarbonitrile is sourced from PubChem (CID 83814960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).