About 5-ethyl-1,4-dimethylpyrazol-3-amine
5-ethyl-1,4-dimethylpyrazol-3-amine (PubChem CID 83815114) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-ethyl-1,4-dimethylpyrazol-3-amine.
Molecular Properties
| Compound Name | 5-ethyl-1,4-dimethylpyrazol-3-amine |
| PubChem CID | 83815114 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 5-ethyl-1,4-dimethylpyrazol-3-amine |
| SMILES | CCc1c(C)c(N)nn1C |
| InChI | InChI=1S/C7H13N3/c1-4-6-5(2)7(8)9-10(6)3/h4H2,1-3H3,(H2,8,9) |
| InChIKey | XQLUCGUMCLQRHO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-1,4-dimethylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,4-dimethylpyrazol-3-amine?
The IUPAC name of 5-ethyl-1,4-dimethylpyrazol-3-amine (CID 83815114) is 5-ethyl-1,4-dimethylpyrazol-3-amine.
What is the SMILES notation for 5-ethyl-1,4-dimethylpyrazol-3-amine?
The canonical SMILES for 5-ethyl-1,4-dimethylpyrazol-3-amine is CCc1c(C)c(N)nn1C.
What is the InChIKey of 5-ethyl-1,4-dimethylpyrazol-3-amine?
The InChIKey is XQLUCGUMCLQRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-4-6-5(2)7(8)9-10(6)3/h4H2,1-3H3,(H2,8,9).
What are the key properties of 5-ethyl-1,4-dimethylpyrazol-3-amine?
5-ethyl-1,4-dimethylpyrazol-3-amine has a molecular weight of 139.20 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,4-dimethylpyrazol-3-amine is sourced from PubChem (CID 83815114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).