About 1-ethyl-1,2,4-triazole-3-carboxylic acid
1-ethyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 83815140) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 1-ethyl-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethyl-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 83815140 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 1-ethyl-1,2,4-triazole-3-carboxylic acid |
| SMILES | CCn1cnc(C(=O)O)n1 |
| InChI | InChI=1S/C5H7N3O2/c1-2-8-3-6-4(7-8)5(9)10/h3H,2H2,1H3,(H,9,10) |
| InChIKey | OFTDEPNAXOCIEU-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 1-ethyl-1,2,4-triazole-3-carboxylic acid (CID 83815140) is 1-ethyl-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 1-ethyl-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 1-ethyl-1,2,4-triazole-3-carboxylic acid is CCn1cnc(C(=O)O)n1.
What is the InChIKey of 1-ethyl-1,2,4-triazole-3-carboxylic acid?
The InChIKey is OFTDEPNAXOCIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-2-8-3-6-4(7-8)5(9)10/h3H,2H2,1H3,(H,9,10).
What are the key properties of 1-ethyl-1,2,4-triazole-3-carboxylic acid?
1-ethyl-1,2,4-triazole-3-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of -0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 83815140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).