C6H7N3S — CID 83815401
5,6-dihydrothieno[2,3-d]pyrimidin-4-amine (PubChem CID 83815401) has the molecular formula C6H7N3S and a molecular weight of 153.21 g/mol. Its IUPAC name is 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 83815401 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1CCS2 |
| InChI | InChI=1S/C6H7N3S/c7-5-4-1-2-10-6(4)9-3-8-5/h3H,1-2H2,(H2,7,8,9) |
| InChIKey | WEHXTNZAKGXJGA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |