About 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine
5,6-dihydrothieno[2,3-d]pyrimidin-4-amine (PubChem CID 83815401) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 83815401 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1CCS2 |
| InChI | InChI=1S/C6H7N3S/c7-5-4-1-2-10-6(4)9-3-8-5/h3H,1-2H2,(H2,7,8,9) |
| InChIKey | WEHXTNZAKGXJGA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine (CID 83815401) is 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine is Nc1ncnc2c1CCS2.
What is the InChIKey of 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine?
The InChIKey is WEHXTNZAKGXJGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c7-5-4-1-2-10-6(4)9-3-8-5/h3H,1-2H2,(H2,7,8,9).
What are the key properties of 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine?
5,6-dihydrothieno[2,3-d]pyrimidin-4-amine has a molecular weight of 153.21 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrothieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 83815401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).