About 3-(thian-4-yl)azetidine
3-(thian-4-yl)azetidine (PubChem CID 83815572) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 3-(thian-4-yl)azetidine.
Molecular Properties
| Compound Name | 3-(thian-4-yl)azetidine |
| PubChem CID | 83815572 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-(thian-4-yl)azetidine |
| SMILES | C1CC(C2CNC2)CCS1 |
| InChI | InChI=1S/C8H15NS/c1-3-10-4-2-7(1)8-5-9-6-8/h7-9H,1-6H2 |
| InChIKey | SOUIJDAKBSCBLR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(thian-4-yl)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thian-4-yl)azetidine?
The IUPAC name of 3-(thian-4-yl)azetidine (CID 83815572) is 3-(thian-4-yl)azetidine.
What is the SMILES notation for 3-(thian-4-yl)azetidine?
The canonical SMILES for 3-(thian-4-yl)azetidine is C1CC(C2CNC2)CCS1.
What is the InChIKey of 3-(thian-4-yl)azetidine?
The InChIKey is SOUIJDAKBSCBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-3-10-4-2-7(1)8-5-9-6-8/h7-9H,1-6H2.
What are the key properties of 3-(thian-4-yl)azetidine?
3-(thian-4-yl)azetidine has a molecular weight of 157.28 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thian-4-yl)azetidine is sourced from PubChem (CID 83815572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).