About 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid (PubChem CID 83815901) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid.
Analyze 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid?
The IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid (CID 83815901) is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid.
What is the SMILES notation for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid?
The canonical SMILES for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid is O=C(O)C1CCCn2nccc21.
What is the InChIKey of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid?
The InChIKey is ZBFRKPKEJMVQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-8(12)6-2-1-5-10-7(6)3-4-9-10/h3-4,6H,1-2,5H2,(H,11,12).
What are the key properties of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid?
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-4-carboxylic acid is sourced from PubChem (CID 83815901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).