C6H6N4S — CID 83815913
4-amino-6-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 83815913) has the molecular formula C6H6N4S and a molecular weight of 166.21 g/mol. Its IUPAC name is 4-amino-6-methylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 83815913 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 4-amino-6-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CSc1ncnc(N)c1C#N |
| InChI | InChI=1S/C6H6N4S/c1-11-6-4(2-7)5(8)9-3-10-6/h3H,1H3,(H2,8,9,10) |
| InChIKey | NEYRQGMPZDOOET-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |