C6H8N4S — CID 83816059
5,6-dihydrothieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 83816059) has the molecular formula C6H8N4S and a molecular weight of 168.22 g/mol. Its IUPAC name is 5,6-dihydrothieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 5,6-dihydrothieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 83816059 |
| Molecular Formula | C6H8N4S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 5,6-dihydrothieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c2c(n1)SCC2 |
| InChI | InChI=1S/C6H8N4S/c7-4-3-1-2-11-5(3)10-6(8)9-4/h1-2H2,(H4,7,8,9,10) |
| InChIKey | ZWUVVCNEUZQTEV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |