2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid

C6H9N3O3 — CID 83816245

IUPAC2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid
SMILESCCn1cnn(CC(=O)O)c1=O
InChIInChI=1S/C6H9N3O3/c1-2-8-4-7-9(6(8)12)3-5(10)11/h4H,2-3H2,1H3,(H,10,11)
InChIKeyIUCZMIZWHBWXLQ-UHFFFAOYSA-N
MW171.16 g/mol
LogP-0.85
Rot. Bonds3

About 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid

2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid (PubChem CID 83816245) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid
PubChem CID83816245
Molecular FormulaC6H9N3O3
Molecular Weight171.16 g/mol
Exact Mass171.06
IUPAC Name2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid
SMILESCCn1cnn(CC(=O)O)c1=O
InChIInChI=1S/C6H9N3O3/c1-2-8-4-7-9(6(8)12)3-5(10)11/h4H,2-3H2,1H3,(H,10,11)
InChIKeyIUCZMIZWHBWXLQ-UHFFFAOYSA-N
XLogP-0.85
TPSA77.12 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.16
LogP ≤ 5-0.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
The IUPAC name of 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid (CID 83816245) is 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid.
What is the SMILES notation for 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
The canonical SMILES for 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid is CCn1cnn(CC(=O)O)c1=O.
What is the InChIKey of 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
The InChIKey is IUCZMIZWHBWXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c1-2-8-4-7-9(6(8)12)3-5(10)11/h4H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid has a molecular weight of 171.16 g/mol, XLogP of -0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-5-oxo-1,2,4-triazol-1-yl)acetic acid is sourced from PubChem (CID 83816245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).