methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate

C8H16N2O2 — CID 83816379

IUPACmethyl 3-amino-2-(1-methylazetidin-3-yl)propanoate
SMILESCOC(=O)C(CN)C1CN(C)C1
InChIInChI=1S/C8H16N2O2/c1-10-4-6(5-10)7(3-9)8(11)12-2/h6-7H,3-5,9H2,1-2H3
InChIKeyCJVHHPQNRCKVFL-UHFFFAOYSA-N
MW172.23 g/mol
LogP-0.70
Rot. Bonds3

About methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate

methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate (PubChem CID 83816379) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-amino-2-(1-methylazetidin-3-yl)propanoate
PubChem CID83816379
Molecular FormulaC8H16N2O2
Molecular Weight172.23 g/mol
Exact Mass172.12
IUPAC Namemethyl 3-amino-2-(1-methylazetidin-3-yl)propanoate
SMILESCOC(=O)C(CN)C1CN(C)C1
InChIInChI=1S/C8H16N2O2/c1-10-4-6(5-10)7(3-9)8(11)12-2/h6-7H,3-5,9H2,1-2H3
InChIKeyCJVHHPQNRCKVFL-UHFFFAOYSA-N
XLogP-0.70
TPSA55.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.23
LogP ≤ 5-0.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate?
The IUPAC name of methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate (CID 83816379) is methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate.
What is the SMILES notation for methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate?
The canonical SMILES for methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate is COC(=O)C(CN)C1CN(C)C1.
What is the InChIKey of methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate?
The InChIKey is CJVHHPQNRCKVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-10-4-6(5-10)7(3-9)8(11)12-2/h6-7H,3-5,9H2,1-2H3.
What are the key properties of methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate?
methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate has a molecular weight of 172.23 g/mol, XLogP of -0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-2-(1-methylazetidin-3-yl)propanoate is sourced from PubChem (CID 83816379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).