About 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol
5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 83816705) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 83816705 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CN(C)c1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C11H15NO/c1-12(2)9-4-5-10-8(7-9)3-6-11(10)13/h4-5,7,11,13H,3,6H2,1-2H3 |
| InChIKey | VZIUATBPXDYCIQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol (CID 83816705) is 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol is CN(C)c1ccc2c(c1)CCC2O.
What is the InChIKey of 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is VZIUATBPXDYCIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-12(2)9-4-5-10-8(7-9)3-6-11(10)13/h4-5,7,11,13H,3,6H2,1-2H3.
What are the key properties of 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol?
5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 177.25 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 83816705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).