C10H14N2O — CID 83816771
2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-7-ol (PubChem CID 83816771) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-7-ol.
| Compound Name | 2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-7-ol |
|---|---|
| PubChem CID | 83816771 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-7-ol |
| SMILES | CC1CCNc2cc(O)ccc2N1 |
| InChI | InChI=1S/C10H14N2O/c1-7-4-5-11-10-6-8(13)2-3-9(10)12-7/h2-3,6-7,11-13H,4-5H2,1H3 |
| InChIKey | GRQBGAOOULVRSV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|