C9H9NOS — CID 83816852
7,8-dihydro-5H-thiopyrano[4,3-b]pyridine-3-carbaldehyde (PubChem CID 83816852) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 7,8-dihydro-5H-thiopyrano[4,3-b]pyridine-3-carbaldehyde.
| Compound Name | 7,8-dihydro-5H-thiopyrano[4,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 83816852 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 7,8-dihydro-5H-thiopyrano[4,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1cnc2c(c1)CSCC2 |
| InChI | InChI=1S/C9H9NOS/c11-5-7-3-8-6-12-2-1-9(8)10-4-7/h3-5H,1-2,6H2 |
| InChIKey | XUVBWSDTEMQVRI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|