About 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid
2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid (PubChem CID 83817180) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid |
| PubChem CID | 83817180 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid |
| SMILES | O=C(O)Cn1ncn(C2CC2)c1=O |
| InChI | InChI=1S/C7H9N3O3/c11-6(12)3-10-7(13)9(4-8-10)5-1-2-5/h4-5H,1-3H2,(H,11,12) |
| InChIKey | AMVZTIYBEXNFNK-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
The IUPAC name of 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid (CID 83817180) is 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid.
What is the SMILES notation for 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
The canonical SMILES for 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid is O=C(O)Cn1ncn(C2CC2)c1=O.
What is the InChIKey of 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
The InChIKey is AMVZTIYBEXNFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3/c11-6(12)3-10-7(13)9(4-8-10)5-1-2-5/h4-5H,1-3H2,(H,11,12).
What are the key properties of 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid?
2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid has a molecular weight of 183.17 g/mol, XLogP of -0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclopropyl-5-oxo-1,2,4-triazol-1-yl)acetic acid is sourced from PubChem (CID 83817180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).