About N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine
N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine (PubChem CID 83817805) has the molecular formula C8H13FN2S
and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine.
Analyze N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine?
The IUPAC name of N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine (CID 83817805) is N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine is CC(C)NC(CF)c1cncs1.
What is the InChIKey of N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine?
The InChIKey is UTJFWWUSHTTYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2S/c1-6(2)11-7(3-9)8-4-10-5-12-8/h4-7,11H,3H2,1-2H3.
What are the key properties of N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine?
N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine has a molecular weight of 188.27 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-fluoro-1-(1,3-thiazol-5-yl)ethyl]propan-2-amine is sourced from PubChem (CID 83817805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).