About N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine
N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine (PubChem CID 83817833) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine |
| PubChem CID | 83817833 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN)C1CSC1 |
| InChI | InChI=1S/C9H20N2S/c1-8(2)5-11(4-3-10)9-6-12-7-9/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | PVQFXLOAYDNETP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine?
The IUPAC name of N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine (CID 83817833) is N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine is CC(C)CN(CCN)C1CSC1.
What is the InChIKey of N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine?
The InChIKey is PVQFXLOAYDNETP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-8(2)5-11(4-3-10)9-6-12-7-9/h8-9H,3-7,10H2,1-2H3.
What are the key properties of N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine?
N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine has a molecular weight of 188.34 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylpropyl)-N'-(thietan-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 83817833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).