About 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole
7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole (PubChem CID 83819465) has the molecular formula C6H8BrN3
and a molecular weight of 202.05 g/mol. Its IUPAC name is 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole |
| PubChem CID | 83819465 |
| Molecular Formula | C6H8BrN3 |
| Molecular Weight | 202.05 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole |
| SMILES | CN1CCn2ncc(Br)c21 |
| InChI | InChI=1S/C6H8BrN3/c1-9-2-3-10-6(9)5(7)4-8-10/h4H,2-3H2,1H3 |
| InChIKey | WMZMFGZVTIQWJV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.05 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole?
The IUPAC name of 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole (CID 83819465) is 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole.
What is the SMILES notation for 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole?
The canonical SMILES for 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole is CN1CCn2ncc(Br)c21.
What is the InChIKey of 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole?
The InChIKey is WMZMFGZVTIQWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3/c1-9-2-3-10-6(9)5(7)4-8-10/h4H,2-3H2,1H3.
What are the key properties of 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole?
7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole has a molecular weight of 202.05 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-methyl-2,3-dihydroimidazo[2,1-e]pyrazole is sourced from PubChem (CID 83819465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).