About 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one
6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 83819619) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 83819619 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)Nc1ccc2c(c1)CCCC2=O |
| InChI | InChI=1S/C13H17NO/c1-9(2)14-11-6-7-12-10(8-11)4-3-5-13(12)15/h6-9,14H,3-5H2,1-2H3 |
| InChIKey | TZZOCNPNYABVST-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one (CID 83819619) is 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one is CC(C)Nc1ccc2c(c1)CCCC2=O.
What is the InChIKey of 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is TZZOCNPNYABVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9(2)14-11-6-7-12-10(8-11)4-3-5-13(12)15/h6-9,14H,3-5H2,1-2H3.
What are the key properties of 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one?
6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 203.28 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(propan-2-ylamino)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 83819619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).