C11H11FN2O — CID 83820003
5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 83820003) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 83820003 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C12CCNC2 |
| InChI | InChI=1S/C11H11FN2O/c12-7-1-2-9-8(5-7)11(10(15)14-9)3-4-13-6-11/h1-2,5,13H,3-4,6H2,(H,14,15) |
| InChIKey | REOJXDBSACKTOM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |