About 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid
2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid (PubChem CID 83820422) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid |
| PubChem CID | 83820422 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C12H16O3/c1-12(2,3)10(11(14)15)8-6-4-5-7-9(8)13/h4-7,10,13H,1-3H3,(H,14,15) |
| InChIKey | WOQYONUAQACIHS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid (CID 83820422) is 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid is CC(C)(C)C(C(=O)O)c1ccccc1O.
What is the InChIKey of 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid?
The InChIKey is WOQYONUAQACIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-12(2,3)10(11(14)15)8-6-4-5-7-9(8)13/h4-7,10,13H,1-3H3,(H,14,15).
What are the key properties of 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid?
2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid has a molecular weight of 208.26 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyphenyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 83820422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).