About (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate
(5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate (PubChem CID 83820913) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate.
Molecular Properties
| Compound Name | (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate |
| PubChem CID | 83820913 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate |
| SMILES | Cc1cncnc1OC(=O)NCC(C)O |
| InChI | InChI=1S/C9H13N3O3/c1-6-3-10-5-12-8(6)15-9(14)11-4-7(2)13/h3,5,7,13H,4H2,1-2H3,(H,11,14) |
| InChIKey | GOODGNDMQUNIAV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate?
The IUPAC name of (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate (CID 83820913) is (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate.
What is the SMILES notation for (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate?
The canonical SMILES for (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate is Cc1cncnc1OC(=O)NCC(C)O.
What is the InChIKey of (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate?
The InChIKey is GOODGNDMQUNIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-6-3-10-5-12-8(6)15-9(14)11-4-7(2)13/h3,5,7,13H,4H2,1-2H3,(H,11,14).
What are the key properties of (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate?
(5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate has a molecular weight of 211.22 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylpyrimidin-4-yl) N-(2-hydroxypropyl)carbamate is sourced from PubChem (CID 83820913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).