C11H19NO3 — CID 83821308
2-(3-hydroxypiperidin-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 83821308) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(3-hydroxypiperidin-1-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(3-hydroxypiperidin-1-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 83821308 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-(3-hydroxypiperidin-1-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1N1CCCC(O)C1 |
| InChI | InChI=1S/C11H19NO3/c13-8-3-2-6-12(7-8)10-5-1-4-9(10)11(14)15/h8-10,13H,1-7H2,(H,14,15) |
| InChIKey | FBNCXGWNYAEPKO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |