About 1,3-benzoxazole-7-sulfonyl chloride
1,3-benzoxazole-7-sulfonyl chloride (PubChem CID 83821826) has the molecular formula C7H4ClNO3S
and a molecular weight of 217.63 g/mol. Its IUPAC name is 1,3-benzoxazole-7-sulfonyl chloride.
Molecular Properties
| Compound Name | 1,3-benzoxazole-7-sulfonyl chloride |
| PubChem CID | 83821826 |
| Molecular Formula | C7H4ClNO3S |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | 1,3-benzoxazole-7-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccc2ncoc12 |
| InChI | InChI=1S/C7H4ClNO3S/c8-13(10,11)6-3-1-2-5-7(6)12-4-9-5/h1-4H |
| InChIKey | UMTOBARUDRSVJT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzoxazole-7-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazole-7-sulfonyl chloride?
The IUPAC name of 1,3-benzoxazole-7-sulfonyl chloride (CID 83821826) is 1,3-benzoxazole-7-sulfonyl chloride.
What is the SMILES notation for 1,3-benzoxazole-7-sulfonyl chloride?
The canonical SMILES for 1,3-benzoxazole-7-sulfonyl chloride is O=S(=O)(Cl)c1cccc2ncoc12.
What is the InChIKey of 1,3-benzoxazole-7-sulfonyl chloride?
The InChIKey is UMTOBARUDRSVJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO3S/c8-13(10,11)6-3-1-2-5-7(6)12-4-9-5/h1-4H.
What are the key properties of 1,3-benzoxazole-7-sulfonyl chloride?
1,3-benzoxazole-7-sulfonyl chloride has a molecular weight of 217.63 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazole-7-sulfonyl chloride is sourced from PubChem (CID 83821826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).