C11H9NO2S — CID 83822098
5-(2-methoxyphenyl)-1,2-thiazole-4-carbaldehyde (PubChem CID 83822098) has the molecular formula C11H9NO2S and a molecular weight of 219.27 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1,2-thiazole-4-carbaldehyde.
| Compound Name | 5-(2-methoxyphenyl)-1,2-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 83822098 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 5-(2-methoxyphenyl)-1,2-thiazole-4-carbaldehyde |
| SMILES | COc1ccccc1-c1sncc1C=O |
| InChI | InChI=1S/C11H9NO2S/c1-14-10-5-3-2-4-9(10)11-8(7-13)6-12-15-11/h2-7H,1H3 |
| InChIKey | FEXBWXPKNMHNHH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|