C14H21NO — CID 83822185
6-(diethylamino)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 83822185) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-(diethylamino)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 6-(diethylamino)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 83822185 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-(diethylamino)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CCN(CC)c1ccc2c(c1)CCCC2O |
| InChI | InChI=1S/C14H21NO/c1-3-15(4-2)12-8-9-13-11(10-12)6-5-7-14(13)16/h8-10,14,16H,3-7H2,1-2H3 |
| InChIKey | YLHGBLKISGEBHZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|