C14H21NO — CID 83822187
2-(5-propan-2-yloxy-2,3-dihydro-1H-inden-1-yl)ethanamine (PubChem CID 83822187) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-(5-propan-2-yloxy-2,3-dihydro-1H-inden-1-yl)ethanamine.
| Compound Name | 2-(5-propan-2-yloxy-2,3-dihydro-1H-inden-1-yl)ethanamine |
|---|---|
| PubChem CID | 83822187 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-(5-propan-2-yloxy-2,3-dihydro-1H-inden-1-yl)ethanamine |
| SMILES | CC(C)Oc1ccc2c(c1)CCC2CCN |
| InChI | InChI=1S/C14H21NO/c1-10(2)16-13-5-6-14-11(7-8-15)3-4-12(14)9-13/h5-6,9-11H,3-4,7-8,15H2,1-2H3 |
| InChIKey | BARYDUNHPIUMCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |