About N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine
N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 83822866) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 83822866 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(CCN)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H18N2O2/c1-9(2)14(6-5-13)10-3-4-11-12(7-10)16-8-15-11/h3-4,7,9H,5-6,8,13H2,1-2H3 |
| InChIKey | OPDWTXLYGCADAK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine (CID 83822866) is N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine is CC(C)N(CCN)c1ccc2c(c1)OCO2.
What is the InChIKey of N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is OPDWTXLYGCADAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-9(2)14(6-5-13)10-3-4-11-12(7-10)16-8-15-11/h3-4,7,9H,5-6,8,13H2,1-2H3.
What are the key properties of N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine?
N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 222.29 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,3-benzodioxol-5-yl)-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 83822866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).