About N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine
N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine (PubChem CID 83822883) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine |
| PubChem CID | 83822883 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine |
| SMILES | NCCN(c1cncnc1)C1CCOCC1 |
| InChI | InChI=1S/C11H18N4O/c12-3-4-15(10-1-5-16-6-2-10)11-7-13-9-14-8-11/h7-10H,1-6,12H2 |
| InChIKey | CUTGBQWCPSOIAB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine?
The IUPAC name of N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine (CID 83822883) is N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine.
What is the SMILES notation for N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine?
The canonical SMILES for N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine is NCCN(c1cncnc1)C1CCOCC1.
What is the InChIKey of N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine?
The InChIKey is CUTGBQWCPSOIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O/c12-3-4-15(10-1-5-16-6-2-10)11-7-13-9-14-8-11/h7-10H,1-6,12H2.
What are the key properties of N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine?
N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine has a molecular weight of 222.29 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(oxan-4-yl)-N'-pyrimidin-5-ylethane-1,2-diamine is sourced from PubChem (CID 83822883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).