About 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol
5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 83823612) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 83823612 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1ccc(C)n1-c1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C15H17NO/c1-10-3-4-11(2)16(10)13-6-7-14-12(9-13)5-8-15(14)17/h3-4,6-7,9,15,17H,5,8H2,1-2H3 |
| InChIKey | JTKAOOQZXMBKKZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol (CID 83823612) is 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol is Cc1ccc(C)n1-c1ccc2c(c1)CCC2O.
What is the InChIKey of 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is JTKAOOQZXMBKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c1-10-3-4-11(2)16(10)13-6-7-14-12(9-13)5-8-15(14)17/h3-4,6-7,9,15,17H,5,8H2,1-2H3.
What are the key properties of 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol?
5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 227.31 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylpyrrol-1-yl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 83823612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).